CAS 117018-19-6 appears in our catalog under these names: 1-(2-Chloro-4-(4-chlorophenoxy)phenyl)-2-(1H-1,2,4-triazol-1-yl)ethan-1-ol, Difenoconazole-alcohol, DIFENOCONAZOL METABOLITE CGA 205375, Difenoconazole-alcohol, Concentration: 100 µg/ml Solvent: Acetonitrile, Difenoconazole-alcohol, Concentration: 100 µg/ml Solvent: Acetone. Offered by: TRC, Dr. Ehrenstorfer, Sigma-Aldrich, HPC Standards. Available pack sizes: 10mg, 5mg, 1x10mg, 1x5ml.
1-[2-chloro-4-(4-chlorophenoxy)phenyl]-2-(1,2,4-triazol-1-yl)ethanol (CAS 117018-19-6) is a chemical compound with the molecular formula C16H13Cl2N3O2 and a molecular weight of 350.2 g/mol. IUPAC name: 1-[2-chloro-4-(4-chlorophenoxy)phenyl]-2-(1,2,4-triazol-1-yl)ethanol. InChIKey: NBYSKMWDHCZSIP-UHFFFAOYSA-N.
| Molecular formula | C16H13Cl2N3O2 |
|---|---|
| Molecular weight | 350.2 g/mol |
| IUPAC name | 1-[2-chloro-4-(4-chlorophenoxy)phenyl]-2-(1,2,4-triazol-1-yl)ethanol |
| InChIKey | NBYSKMWDHCZSIP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=CC(=C(C=C2)C(CN3C=NC=N3)O)Cl)Cl |
Computed by PubChem (NCBI)