CAS 1025015-40-0 appears in our catalog under these names: GK921/ 99.49% (existing batch purity), GK921, GK921 99%, GK921, 99%, 99%, GK921, 99.91%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 100 mg.
3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)pyrido[2,3-b]pyrazine (CAS 1025015-40-0) is a chemical compound with the molecular formula C21H20N4O and a molecular weight of 344.4 g/mol. IUPAC name: 3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)pyrido[2,3-b]pyrazine. InChIKey: MNYJJHBAEYKXEG-UHFFFAOYSA-N.
| Molecular formula | C21H20N4O |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 3-(2-phenylethynyl)-2-(2-pyrrolidin-1-ylethoxy)pyrido[2,3-b]pyrazine |
| InChIKey | MNYJJHBAEYKXEG-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CCOC2=NC3=C(N=CC=C3)N=C2C#CC4=CC=CC=C4 |
Computed by PubChem (NCBI)