cas: 2055015-61-5 — see every product listed under this CAS number, including other names
GLPG2451 (CAS 2055015-61-5) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 1mg, 10mg, 10mM (in 1ml dmso), 25mg, 50mg, 100mg. Offered by: GLPBio, Biosynth, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC74987-5 |
| cas | 2055015-61-5 |
| size | 5mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| GLPBio | 5mg | 1743.76 Pln | |
| GLPBio | 1mg | 943.40 Pln | |
| GLPBio | 10mg | 2502.00 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 1874.82 Pln | |
| Biosynth | 25mg | price on request | |
| Biosynth | 50mg | price on request | |
| Chemat | 25mg | 3885.20 Pln | |
| Chemat | 50mg | 5262.80 Pln | |
| Chemat | 100mg | 6856.40 Pln | |
| Chemat | 1mg | 698.00 Pln | |
| Chemat | 5mg | 1672.40 Pln | |
| Chemat | 10mg | 2450.00 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
3-amino-N-[(2S)-2-hydroxypropyl]-5-[4-(trifluoromethoxy)phenyl]sulfonylpyridine-2-carboxamide (CAS 2055015-61-5) is a chemical compound with the molecular formula C16H16F3N3O5S and a molecular weight of 419.4 g/mol. IUPAC name: 3-amino-N-[(2S)-2-hydroxypropyl]-5-[4-(trifluoromethoxy)phenyl]sulfonylpyridine-2-carboxamide. InChIKey: UMOGNCVNHXWFIX-VIFPVBQESA-N.
| Molecular formula | C16H16F3N3O5S |
|---|---|
| Molecular weight | 419.4 g/mol |
| IUPAC name | 3-amino-N-[(2S)-2-hydroxypropyl]-5-[4-(trifluoromethoxy)phenyl]sulfonylpyridine-2-carboxamide |
| InChIKey | UMOGNCVNHXWFIX-VIFPVBQESA-N |
| SMILES | C[C@@H](CNC(=O)C1=C(C=C(C=N1)S(=O)(=O)C2=CC=C(C=C2)OC(F)(F)F)N)O |
Computed by PubChem (NCBI)