CAS 2055015-61-5 appears in our catalog under these names: GLPG2451, GLPG2451, 95%, GLPG2451, 99.68%. Offered by: GLPBio, AmBeed, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 100mg, 1mg, 10mg, 10mM (in 1ml dmso), 25mg, 50mg, 10 mg.
3-amino-N-[(2S)-2-hydroxypropyl]-5-[4-(trifluoromethoxy)phenyl]sulfonylpyridine-2-carboxamide (CAS 2055015-61-5) is a chemical compound with the molecular formula C16H16F3N3O5S and a molecular weight of 419.4 g/mol. IUPAC name: 3-amino-N-[(2S)-2-hydroxypropyl]-5-[4-(trifluoromethoxy)phenyl]sulfonylpyridine-2-carboxamide. InChIKey: UMOGNCVNHXWFIX-VIFPVBQESA-N.
| Molecular formula | C16H16F3N3O5S |
|---|---|
| Molecular weight | 419.4 g/mol |
| IUPAC name | 3-amino-N-[(2S)-2-hydroxypropyl]-5-[4-(trifluoromethoxy)phenyl]sulfonylpyridine-2-carboxamide |
| InChIKey | UMOGNCVNHXWFIX-VIFPVBQESA-N |
| SMILES | C[C@@H](CNC(=O)C1=C(C=C(C=N1)S(=O)(=O)C2=CC=C(C=C2)OC(F)(F)F)N)O |
Computed by PubChem (NCBI)