CAS 5361-15-9 appears in our catalog under these names: GMQ hydrochloride/ 99.88% (existing batch purity), GMQ hydrochloride, GMQ hydrochloride, GMQ (hydrochloride), 99.86%. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 200mg, 10mg, 0,5g, 1g, 2g.
2-(4-methylquinazolin-2-yl)guanidine;hydrochloride (CAS 5361-15-9) is a chemical compound with the molecular formula C10H12ClN5 and a molecular weight of 237.69 g/mol. IUPAC name: 2-(4-methylquinazolin-2-yl)guanidine;hydrochloride. InChIKey: VNPZWQRWOHFAPD-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN5 |
|---|---|
| Molecular weight | 237.69 g/mol |
| IUPAC name | 2-(4-methylquinazolin-2-yl)guanidine;hydrochloride |
| InChIKey | VNPZWQRWOHFAPD-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC2=CC=CC=C12)N=C(N)N.Cl |
Computed by PubChem (NCBI)