Products 1629063-81-5
CAS 1629063-81-5 appears in our catalog under these names: GNE–131, GNE-131/ 99.29% (existing batch purity), GNE 131, GNE-131 98%, GNE-131, 98%, 98%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 2mg.
N-[7-(1-adamantylmethoxy)-6-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl]cyclopropanesulfonamide (CAS 1629063-81-5) is a chemical compound with the molecular formula C23H30N4O3S and a molecular weight of 442.6 g/mol. IUPAC name: N-[7-(1-adamantylmethoxy)-6-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl]cyclopropanesulfonamide. InChIKey: FPERPEQIXLOVIK-UHFFFAOYSA-N.
| Molecular formula | C23H30N4O3S |
|---|---|
| Molecular weight | 442.6 g/mol |
| IUPAC name | N-[7-(1-adamantylmethoxy)-6-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl]cyclopropanesulfonamide |
| InChIKey | FPERPEQIXLOVIK-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CN3C(=NN=C3NS(=O)(=O)C4CC4)C=C2OCC56CC7CC(C5)CC(C7)C6 |
Computed by PubChem (NCBI)