CAS 2009273-67-8 appears in our catalog under these names: GNE-6640/ 99.59% (existing batch purity), GNE–6640, GNE-6640, GNE-6640 98%, GNE-6640, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
4-[2-amino-4-ethyl-5-(1H-indazol-5-yl)-3-pyridinyl]phenol (CAS 2009273-67-8) is a chemical compound with the molecular formula C20H18N4O and a molecular weight of 330.4 g/mol. IUPAC name: 4-[2-amino-4-ethyl-5-(1H-indazol-5-yl)-3-pyridinyl]phenol. InChIKey: ZHYXJQQBKROZDX-UHFFFAOYSA-N.
| Molecular formula | C20H18N4O |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 4-[2-amino-4-ethyl-5-(1H-indazol-5-yl)-3-pyridinyl]phenol |
| InChIKey | ZHYXJQQBKROZDX-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=NC=C1C2=CC3=C(C=C2)NN=C3)N)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)