CAS 1374828-69-9 appears in our catalog under these names: GNE-0877, >95% (HPLC), GNE0877/ 99.96% (existing batch purity), GNE0877, GNE-0877, 99%, 99%, GNE0877, 99.81%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 2mg, 10mg, 25mg, 50mg, 100mg, 500mg.
2-methyl-2-[3-methyl-4-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]pyrazol-1-yl]propanenitrile (CAS 1374828-69-9) is a chemical compound with the molecular formula C14H16F3N7 and a molecular weight of 339.32 g/mol. IUPAC name: 2-methyl-2-[3-methyl-4-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]pyrazol-1-yl]propanenitrile. InChIKey: ZPPUMAMZIMPJGP-UHFFFAOYSA-N.
| Molecular formula | C14H16F3N7 |
|---|---|
| Molecular weight | 339.32 g/mol |
| IUPAC name | 2-methyl-2-[3-methyl-4-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]pyrazol-1-yl]propanenitrile |
| InChIKey | ZPPUMAMZIMPJGP-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1NC2=NC=C(C(=N2)NC)C(F)(F)F)C(C)(C)C#N |
Computed by PubChem (NCBI)