Products 778277-15-9
CAS 778277-15-9 appears in our catalog under these names: GNF-5/ 99.78% (existing batch purity), GNF 5, GNF-5, 95%, GNF-5 99%, Bcr-abl Inhibitor III, GNF-5 1PC X 10MG. Offered by: TargetMol, GLPBio, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 10mM (in 1ml dmso).
N-(2-hydroxyethyl)-3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzamide (CAS 778277-15-9) is a chemical compound with the molecular formula C20H17F3N4O3 and a molecular weight of 418.4 g/mol. IUPAC name: N-(2-hydroxyethyl)-3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzamide. InChIKey: IIQUYGWWHIHOCF-UHFFFAOYSA-N.
| Molecular formula | C20H17F3N4O3 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | N-(2-hydroxyethyl)-3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzamide |
| InChIKey | IIQUYGWWHIHOCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)NCCO)C2=CC(=NC=N2)NC3=CC=C(C=C3)OC(F)(F)F |
Computed by PubChem (NCBI)