CAS 77603-42-0 appears in our catalog under these names: GNF-PF-3777/ 99.47% (existing batch purity), GNF-PF-3777, GNF-PF-3777 98%, 8-Nitroindolo[2,1-b]quinazoline-6,12-dione, 98%, 98%, GNF-PF-3777, 98.03%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
8-nitroindolo[2,1-b]quinazoline-6,12-dione (CAS 77603-42-0) is a chemical compound with the molecular formula C15H7N3O4 and a molecular weight of 293.23 g/mol. IUPAC name: 8-nitroindolo[2,1-b]quinazoline-6,12-dione. InChIKey: UFMQJYHLIUACCG-UHFFFAOYSA-N.
| Molecular formula | C15H7N3O4 |
|---|---|
| Molecular weight | 293.23 g/mol |
| IUPAC name | 8-nitroindolo[2,1-b]quinazoline-6,12-dione |
| InChIKey | UFMQJYHLIUACCG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N3C4=C(C=C(C=C4)[N+](=O)[O-])C(=O)C3=N2 |
Computed by PubChem (NCBI)