Products 307983-31-9
CAS 307983-31-9 appears in our catalog under these names: GRA Ex-25/ 97.39% (existing batch purity), GRA Ex–25, GRA Ex-25 99%, 3-(4-((1-(trans-4-(tert-Butyl)cyclohexyl)-3-(4-(trifluoromethoxy)phenyl)ureido)methyl)benzamido)propanoic acid, 99%, 99%, GRA Ex-25, 99.07%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
3-[[4-[[(4-tert-butylcyclohexyl)-[[4-(trifluoromethoxy)phenyl]carbamoyl]amino]methyl]benzoyl]amino]propanoic acid (CAS 307983-31-9) is a chemical compound with the molecular formula C29H36F3N3O5 and a molecular weight of 563.6 g/mol. IUPAC name: 3-[[4-[[(4-tert-butylcyclohexyl)-[[4-(trifluoromethoxy)phenyl]carbamoyl]amino]methyl]benzoyl]amino]propanoic acid. InChIKey: BZXMLCVDKDXRQY-UHFFFAOYSA-N.
| Molecular formula | C29H36F3N3O5 |
|---|---|
| Molecular weight | 563.6 g/mol |
| IUPAC name | 3-[[4-[[(4-tert-butylcyclohexyl)-[[4-(trifluoromethoxy)phenyl]carbamoyl]amino]methyl]benzoyl]amino]propanoic acid |
| InChIKey | BZXMLCVDKDXRQY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC(CC1)N(CC2=CC=C(C=C2)C(=O)NCCC(=O)O)C(=O)NC3=CC=C(C=C3)OC(F)(F)F |
Computed by PubChem (NCBI)