CAS 1301761-96-5 appears in our catalog under these names: GSK–114, GSK-114/ 98.03% (existing batch purity), GSK-114 98+%, 3-((6,7-Dimethoxyquinazolin-4-yl)amino)-4-(dimethylamino)-N-methylbenzenesulfonamide, 98+%, 98+%, GSK-114, 99.52%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 250mg, 50 mg.
3-[(6,7-dimethoxyquinazolin-4-yl)amino]-4-(dimethylamino)-N-methylbenzenesulfonamide (CAS 1301761-96-5) is a chemical compound with the molecular formula C19H23N5O4S and a molecular weight of 417.5 g/mol. IUPAC name: 3-[(6,7-dimethoxyquinazolin-4-yl)amino]-4-(dimethylamino)-N-methylbenzenesulfonamide. InChIKey: YUSROMRPOFFTMX-UHFFFAOYSA-N.
| Molecular formula | C19H23N5O4S |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | 3-[(6,7-dimethoxyquinazolin-4-yl)amino]-4-(dimethylamino)-N-methylbenzenesulfonamide |
| InChIKey | YUSROMRPOFFTMX-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC(=C(C=C1)N(C)C)NC2=NC=NC3=CC(=C(C=C32)OC)OC |
Computed by PubChem (NCBI)