cas: 1539314-06-1 — see every product listed under this CAS number, including other names
GSK-2881078 98+% (CAS 1539314-06-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A275241-1mg |
| cas | 1539314-06-1 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 292.50 Pln | |
| Ambeed | 5mg | 348.12 Pln | |
| Ambeed | 10mg | 426.00 Pln | |
| Ambeed | 25mg | 531.69 Pln | |
| Ambeed | 50mg | 659.62 Pln | |
| Ambeed | 100mg | 982.25 Pln | |
| Ambeed | 250mg | 1799.94 Pln | |
| Ambeed | 1g | 4736.94 Pln |
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A275241 |
1-[(2R)-1-methylsulfonylpropan-2-yl]-4-(trifluoromethyl)indole-5-carbonitrile (CAS 1539314-06-1) is a chemical compound with the molecular formula C14H13F3N2O2S and a molecular weight of 330.33 g/mol. IUPAC name: 1-[(2R)-1-methylsulfonylpropan-2-yl]-4-(trifluoromethyl)indole-5-carbonitrile. InChIKey: SKDVMPZQJMZEAC-SECBINFHSA-N.
| Molecular formula | C14H13F3N2O2S |
|---|---|
| Molecular weight | 330.33 g/mol |
| IUPAC name | 1-[(2R)-1-methylsulfonylpropan-2-yl]-4-(trifluoromethyl)indole-5-carbonitrile |
| InChIKey | SKDVMPZQJMZEAC-SECBINFHSA-N |
| SMILES | C[C@H](CS(=O)(=O)C)N1C=CC2=C1C=CC(=C2C(F)(F)F)C#N |
Computed by PubChem (NCBI)