CAS 1539314-06-1 appears in our catalog under these names: GSK 2881078, GSK-2881078/ 99.65% (existing batch purity), GSK2881078, GSK-2881078 98+%, GSK2881078, 98+%, 98+%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 500mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1mg.
1-[(2R)-1-methylsulfonylpropan-2-yl]-4-(trifluoromethyl)indole-5-carbonitrile (CAS 1539314-06-1) is a chemical compound with the molecular formula C14H13F3N2O2S and a molecular weight of 330.33 g/mol. IUPAC name: 1-[(2R)-1-methylsulfonylpropan-2-yl]-4-(trifluoromethyl)indole-5-carbonitrile. InChIKey: SKDVMPZQJMZEAC-SECBINFHSA-N.
| Molecular formula | C14H13F3N2O2S |
|---|---|
| Molecular weight | 330.33 g/mol |
| IUPAC name | 1-[(2R)-1-methylsulfonylpropan-2-yl]-4-(trifluoromethyl)indole-5-carbonitrile |
| InChIKey | SKDVMPZQJMZEAC-SECBINFHSA-N |
| SMILES | C[C@H](CS(=O)(=O)C)N1C=CC2=C1C=CC(=C2C(F)(F)F)C#N |
Computed by PubChem (NCBI)