CAS 2101305-84-2 appears in our catalog under these names: GSK-690/ 98.65% (existing batch purity), GSK690, GSK-690, GSK 690. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, Get quote.
4-[2-(4-methylphenyl)-5-[[(3R)-pyrrolidin-3-yl]methoxy]-3-pyridinyl]benzonitrile (CAS 2101305-84-2) is a chemical compound with the molecular formula C24H23N3O and a molecular weight of 369.5 g/mol. IUPAC name: 4-[2-(4-methylphenyl)-5-[[(3R)-pyrrolidin-3-yl]methoxy]-3-pyridinyl]benzonitrile. InChIKey: IQVDLEXWAPYWDT-LJQANCHMSA-N.
| Molecular formula | C24H23N3O |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | 4-[2-(4-methylphenyl)-5-[[(3R)-pyrrolidin-3-yl]methoxy]-3-pyridinyl]benzonitrile |
| InChIKey | IQVDLEXWAPYWDT-LJQANCHMSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(C=C(C=N2)OC[C@@H]3CCNC3)C4=CC=C(C=C4)C#N |
Computed by PubChem (NCBI)