CAS 1416334-69-4 appears in our catalog under these names: GSK-A1/ 98.97% (existing batch purity), GSK–A1, Pi4Ka inhibitor-A1, GSK-A1, GSK-A1, 98.03% ,, 98.03% ,. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 0,25g, 0,5g, 1g, 25mg, 50mg.
5-[2-amino-3-(4-morpholin-4-ylphenyl)benzimidazol-5-yl]-N-(2-fluorophenyl)-2-methoxypyridine-3-sulfonamide (CAS 1416334-69-4) is a chemical compound with the molecular formula C29H27FN6O4S and a molecular weight of 574.6 g/mol. IUPAC name: 5-[2-amino-3-(4-morpholin-4-ylphenyl)benzimidazol-5-yl]-N-(2-fluorophenyl)-2-methoxypyridine-3-sulfonamide. InChIKey: AJOGHKUZDLYXKS-UHFFFAOYSA-N.
| Molecular formula | C29H27FN6O4S |
|---|---|
| Molecular weight | 574.6 g/mol |
| IUPAC name | 5-[2-amino-3-(4-morpholin-4-ylphenyl)benzimidazol-5-yl]-N-(2-fluorophenyl)-2-methoxypyridine-3-sulfonamide |
| InChIKey | AJOGHKUZDLYXKS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=N1)C2=CC3=C(C=C2)N=C(N3C4=CC=C(C=C4)N5CCOCC5)N)S(=O)(=O)NC6=CC=CC=C6F |
Computed by PubChem (NCBI)