CAS 1032823-75-8 appears in our catalog under these names: GSK1292263/ 99.16% (existing batch purity), GSK1292263, GSK1292263, 99.71%, GSK1292263 (Standard). Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 100 mg.
5-[4-[[6-(4-methylsulfonylphenyl)-3-pyridinyl]oxymethyl]piperidin-1-yl]-3-propan-2-yl-1,2,4-oxadiazole (CAS 1032823-75-8) is a chemical compound with the molecular formula C23H28N4O4S and a molecular weight of 456.6 g/mol. IUPAC name: 5-[4-[[6-(4-methylsulfonylphenyl)-3-pyridinyl]oxymethyl]piperidin-1-yl]-3-propan-2-yl-1,2,4-oxadiazole. InChIKey: AYJRTVVIBJSSKN-UHFFFAOYSA-N.
| Molecular formula | C23H28N4O4S |
|---|---|
| Molecular weight | 456.6 g/mol |
| IUPAC name | 5-[4-[[6-(4-methylsulfonylphenyl)-3-pyridinyl]oxymethyl]piperidin-1-yl]-3-propan-2-yl-1,2,4-oxadiazole |
| InChIKey | AYJRTVVIBJSSKN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NOC(=N1)N2CCC(CC2)COC3=CN=C(C=C3)C4=CC=C(C=C4)S(=O)(=O)C |
Computed by PubChem (NCBI)