CAS 720690-73-3 appears in our catalog under these names: GSK189254A/ 98.04% (existing batch purity), GSK189254A, GSK189254A 99%, GSK189254, 99%, 99%, GSK189254A, 98.59%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg, 0,5g, 25mg, 100 mg.
6-[(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)oxy]-N-methylpyridine-3-carboxamide (CAS 720690-73-3) is a chemical compound with the molecular formula C21H25N3O2 and a molecular weight of 351.4 g/mol. IUPAC name: 6-[(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)oxy]-N-methylpyridine-3-carboxamide. InChIKey: WROHEWWOCPRMIA-UHFFFAOYSA-N.
| Molecular formula | C21H25N3O2 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 6-[(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)oxy]-N-methylpyridine-3-carboxamide |
| InChIKey | WROHEWWOCPRMIA-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CN=C(C=C1)OC2=CC3=C(CCN(CC3)C4CCC4)C=C2 |
Computed by PubChem (NCBI)