Products 1034688-30-6
CAS 1034688-30-6 appears in our catalog under these names: GSK2018682/ 97.78% (existing batch purity), GSK2018682, GSK 2018682, 4-(4-(5-(5-Chloro-6-isopropoxypyridin-3-yl)-1,2,4-oxadiazol-3-yl)-1H-indol-1-yl)butanoic acid, 98%, 98%, GSK2018682, 98.02%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 10mM (in 1ml dmso).
4-[4-[5-(5-chloro-6-propan-2-yloxy-3-pyridinyl)-1,2,4-oxadiazol-3-yl]indol-1-yl]butanoic acid (CAS 1034688-30-6) is a chemical compound with the molecular formula C22H21ClN4O4 and a molecular weight of 440.9 g/mol. IUPAC name: 4-[4-[5-(5-chloro-6-propan-2-yloxy-3-pyridinyl)-1,2,4-oxadiazol-3-yl]indol-1-yl]butanoic acid. InChIKey: NFIGDBFIDKDNIG-UHFFFAOYSA-N.
| Molecular formula | C22H21ClN4O4 |
|---|---|
| Molecular weight | 440.9 g/mol |
| IUPAC name | 4-[4-[5-(5-chloro-6-propan-2-yloxy-3-pyridinyl)-1,2,4-oxadiazol-3-yl]indol-1-yl]butanoic acid |
| InChIKey | NFIGDBFIDKDNIG-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=N1)C2=NC(=NO2)C3=C4C=CN(C4=CC=C3)CCCC(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
orb1220323, orb1299885