CAS 1337531-06-2 appears in our catalog under these names: GSK2593074A, 98%, GSK2593074A/ 100%, GSK2593074A, GSK2593074A, 99.07%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 2mg, 5 mg.
1-[5-[4-amino-7-(1-methylpyrazol-4-yl)thieno[3,2-c]pyridin-3-yl]-2,3-dihydroindol-1-yl]-2-phenylethanone (CAS 1337531-06-2) is a chemical compound with the molecular formula C27H23N5OS and a molecular weight of 465.6 g/mol. IUPAC name: 1-[5-[4-amino-7-(1-methylpyrazol-4-yl)thieno[3,2-c]pyridin-3-yl]-2,3-dihydroindol-1-yl]-2-phenylethanone. InChIKey: LIGGMBSSOOVGAE-UHFFFAOYSA-N.
| Molecular formula | C27H23N5OS |
|---|---|
| Molecular weight | 465.6 g/mol |
| IUPAC name | 1-[5-[4-amino-7-(1-methylpyrazol-4-yl)thieno[3,2-c]pyridin-3-yl]-2,3-dihydroindol-1-yl]-2-phenylethanone |
| InChIKey | LIGGMBSSOOVGAE-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=CN=C(C3=C2SC=C3C4=CC5=C(C=C4)N(CC5)C(=O)CC6=CC=CC=C6)N |
Computed by PubChem (NCBI)