CAS 2449301-27-1 appears in our catalog under these names: GSK2643943A/ 98.06% (existing batch purity), GSK2643943A, GSK2643943A 98%, 2-Amino-6-(3-fluorostyryl)-1H-indole-3-carbonitrile, 98%, 98%, GSK2643943A, 98.79%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 50 mg.
2-amino-6-[(E)-2-(3-fluorophenyl)ethenyl]-1H-indole-3-carbonitrile (CAS 2449301-27-1) is a chemical compound with the molecular formula C17H12FN3 and a molecular weight of 277.29 g/mol. IUPAC name: 2-amino-6-[(E)-2-(3-fluorophenyl)ethenyl]-1H-indole-3-carbonitrile. InChIKey: CGXBPMZRTMXEIA-SNAWJCMRSA-N.
| Molecular formula | C17H12FN3 |
|---|---|
| Molecular weight | 277.29 g/mol |
| IUPAC name | 2-amino-6-[(E)-2-(3-fluorophenyl)ethenyl]-1H-indole-3-carbonitrile |
| InChIKey | CGXBPMZRTMXEIA-SNAWJCMRSA-N |
| SMILES | C1=CC(=CC(=C1)F)/C=C/C2=CC3=C(C=C2)C(=C(N3)N)C#N |
Computed by PubChem (NCBI)