CAS 188591-46-0 appears in our catalog under these names: GSK3787/ 98.53% (existing batch purity), GSK3787, GSK3787 99%, PPAR╬▓/╬┤ Antagonist, GSK3787 1PC X 10MG, GSK3787, 99.94%. Offered by: TargetMol, GLPBio, Ambeed, Sigma-Aldrich, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso), 1mg.
4-chloro-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl]benzamide (CAS 188591-46-0) is a chemical compound with the molecular formula C15H12ClF3N2O3S and a molecular weight of 392.8 g/mol. IUPAC name: 4-chloro-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl]benzamide. InChIKey: JFUIMTGOQCQTPF-UHFFFAOYSA-N.
| Molecular formula | C15H12ClF3N2O3S |
|---|---|
| Molecular weight | 392.8 g/mol |
| IUPAC name | 4-chloro-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl]benzamide |
| InChIKey | JFUIMTGOQCQTPF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NCCS(=O)(=O)C2=NC=C(C=C2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)