CAS 877387-37-6 appears in our catalog under these names: GSK5182, 97%, GSK5182/ 97.63% (existing batch purity), GSK5182, GSK5182 98%, GSK5182, 99.42% ,, 99.42% ,. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg.
4-[(Z)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol (CAS 877387-37-6) is a chemical compound with the molecular formula C27H31NO3 and a molecular weight of 417.5 g/mol. IUPAC name: 4-[(Z)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol. InChIKey: ZVSFNBNLNLXEFQ-RQZHXJHFSA-N.
| Molecular formula | C27H31NO3 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | 4-[(Z)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol |
| InChIKey | ZVSFNBNLNLXEFQ-RQZHXJHFSA-N |
| SMILES | CN(C)CCOC1=CC=C(C=C1)/C(=C(/CCCO)\C2=CC=CC=C2)/C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)