CAS 1346547-00-9 appears in our catalog under these names: GSK583/ 98.68% (existing batch purity), GSK583, GSK 583, GSK583, 95%, GSK583 98%. Offered by: TargetMol, GLPBio, Biosynth, Thermo Scientific (Acros), Ambeed. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
6-tert-butylsulfonyl-N-(5-fluoro-1H-indazol-3-yl)quinolin-4-amine (CAS 1346547-00-9) is a chemical compound with the molecular formula C20H19FN4O2S and a molecular weight of 398.5 g/mol. IUPAC name: 6-tert-butylsulfonyl-N-(5-fluoro-1H-indazol-3-yl)quinolin-4-amine. InChIKey: XLOGLWKOHPIJLV-UHFFFAOYSA-N.
| Molecular formula | C20H19FN4O2S |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | 6-tert-butylsulfonyl-N-(5-fluoro-1H-indazol-3-yl)quinolin-4-amine |
| InChIKey | XLOGLWKOHPIJLV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)S(=O)(=O)C1=CC2=C(C=CN=C2C=C1)NC3=NNC4=C3C=C(C=C4)F |
Computed by PubChem (NCBI)