CAS 151386-96-8 appears in our catalog under these names: GV-150013X/ 100%, GV-150013X, GV150013X. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10 mg.
1-[(3S)-1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]-3-phenylurea (CAS 151386-96-8) is a chemical compound with the molecular formula C33H34N4O3 and a molecular weight of 534.6 g/mol. IUPAC name: 1-[(3S)-1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]-3-phenylurea. InChIKey: RZERRLOTRSJIAW-NGYFYKNKSA-N.
| Molecular formula | C33H34N4O3 |
|---|---|
| Molecular weight | 534.6 g/mol |
| IUPAC name | 1-[(3S)-1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]-3-phenylurea |
| InChIKey | RZERRLOTRSJIAW-NGYFYKNKSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)CN4C5=CC=CC=C5N(C(=O)[C@H](C4=O)NC(=O)NC6=CC=CC=C6)C7=CC=CC=C7 |
Computed by PubChem (NCBI)