CAS 579515-63-2 appears in our catalog under these names: GW806742X/ 99.07% (existing batch purity), GW806742X, GW806742X 98%, GW806742X, 98%, 98%, GW806742X, 99.91%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 10mM/1mL.
1-[4-[methyl-[2-(3-sulfamoylanilino)pyrimidin-4-yl]amino]phenyl]-3-[4-(trifluoromethoxy)phenyl]urea (CAS 579515-63-2) is a chemical compound with the molecular formula C25H22F3N7O4S and a molecular weight of 573.5 g/mol. IUPAC name: 1-[4-[methyl-[2-(3-sulfamoylanilino)pyrimidin-4-yl]amino]phenyl]-3-[4-(trifluoromethoxy)phenyl]urea. InChIKey: SNRUTMWCDZHKKM-UHFFFAOYSA-N.
| Molecular formula | C25H22F3N7O4S |
|---|---|
| Molecular weight | 573.5 g/mol |
| IUPAC name | 1-[4-[methyl-[2-(3-sulfamoylanilino)pyrimidin-4-yl]amino]phenyl]-3-[4-(trifluoromethoxy)phenyl]urea |
| InChIKey | SNRUTMWCDZHKKM-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=C(C=C1)NC(=O)NC2=CC=C(C=C2)OC(F)(F)F)C3=NC(=NC=C3)NC4=CC(=CC=C4)S(=O)(=O)N |
Computed by PubChem (NCBI)