CAS 2101315-36-8 appears in our catalog under these names: Gboxin/ 99.58% (existing batch purity), Gboxin, Gboxin 98%, 2-Ethyl-3-(2-(((1R,2S,5R)-2-isopropyl-5-methylcyclohexyl)oxy)-2-oxoethyl)-1-methyl-1H-benzo[d]imidazol-3-ium chloride, 98%, 98%, Gboxin, 98.23%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-ethyl-3-methylbenzimidazol-3-ium-1-yl)acetate chloride (CAS 2101315-36-8) is a chemical compound with the molecular formula C22H33ClN2O2 and a molecular weight of 393.0 g/mol. IUPAC name: [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-ethyl-3-methylbenzimidazol-3-ium-1-yl)acetate chloride. InChIKey: UBWVTCCKVGOTBG-VYZBTARASA-M.
| Molecular formula | C22H33ClN2O2 |
|---|---|
| Molecular weight | 393.0 g/mol |
| IUPAC name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-ethyl-3-methylbenzimidazol-3-ium-1-yl)acetate chloride |
| InChIKey | UBWVTCCKVGOTBG-VYZBTARASA-M |
| SMILES | CCC1=[N+](C2=CC=CC=C2N1CC(=O)O[C@@H]3C[C@@H](CC[C@H]3C(C)C)C)C.[Cl-] |
Computed by PubChem (NCBI)