cas: 529488-28-6 — see every product listed under this CAS number, including other names
Genz-644282 99% (CAS 529488-28-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A204687-1mg |
| cas | 529488-28-6 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 248.00 Pln | |
| Ambeed | 5mg | 414.88 Pln | |
| Ambeed | 10mg | 631.81 Pln | |
| Ambeed | 25mg | 1238.12 Pln | |
| Ambeed | 50mg | 1471.75 Pln | |
| Ambeed | 100mg | 2172.62 Pln | |
| Ambeed | 250mg | 5315.44 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A204687 |
16,17-dimethoxy-21-[2-(methylamino)ethyl]-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18-octaen-20-one (CAS 529488-28-6) is a chemical compound with the molecular formula C22H21N3O5 and a molecular weight of 407.4 g/mol. IUPAC name: 16,17-dimethoxy-21-[2-(methylamino)ethyl]-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18-octaen-20-one. InChIKey: BAORCAMWLWRZQG-UHFFFAOYSA-N.
| Molecular formula | C22H21N3O5 |
|---|---|
| Molecular weight | 407.4 g/mol |
| IUPAC name | 16,17-dimethoxy-21-[2-(methylamino)ethyl]-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18-octaen-20-one |
| InChIKey | BAORCAMWLWRZQG-UHFFFAOYSA-N |
| SMILES | CNCCN1C2=C(C=NC3=CC4=C(C=C32)OCO4)C5=CC(=C(C=C5C1=O)OC)OC |
Computed by PubChem (NCBI)