CAS 2058231-15-3 appears in our catalog under these names: Tadalafil Impurity 41, Tadalafil Impurity 66, Tadalafil open ring acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(1R,3R)-1-(1,3-benzodioxol-5-yl)-2-[2-(methylamino)acetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid (CAS 2058231-15-3) is a chemical compound with the molecular formula C22H21N3O5 and a molecular weight of 407.4 g/mol. IUPAC name: (1R,3R)-1-(1,3-benzodioxol-5-yl)-2-[2-(methylamino)acetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid. InChIKey: MUUFJIFAAHRREF-IIBYNOLFSA-N.
| Molecular formula | C22H21N3O5 |
|---|---|
| Molecular weight | 407.4 g/mol |
| IUPAC name | (1R,3R)-1-(1,3-benzodioxol-5-yl)-2-[2-(methylamino)acetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
| InChIKey | MUUFJIFAAHRREF-IIBYNOLFSA-N |
| SMILES | CNCC(=O)N1[C@H](CC2=C([C@H]1C3=CC4=C(C=C3)OCO4)NC5=CC=CC=C25)C(=O)O |
Computed by PubChem (NCBI)