CAS 29031-19-4 appears in our catalog under these names: D-Glucosamine sulfate, 95%, D-Glucosamine Salt (Sulfate/Chloride), D-Glucosamine Sulfate Salt, Glucosamine sulfate, Glucosamine sulfate/ 99.49% (existing batch purity). Offered by: Combi-blocks, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: 25g, 5g, 1g, 100g, 20mg, 500mg, 50g, 5 g.
Bis((2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal);sulfuric acid (CAS 29031-19-4) is a chemical compound with the molecular formula C12H28N2O14S and a molecular weight of 456.42 g/mol. IUPAC name: bis((2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal);sulfuric acid. InChIKey: WLNBMPZUVDTASE-HXIISURNSA-N.
| Molecular formula | C12H28N2O14S |
|---|---|
| Molecular weight | 456.42 g/mol |
| IUPAC name | bis((2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal);sulfuric acid |
| InChIKey | WLNBMPZUVDTASE-HXIISURNSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@H](C=O)N)O)O)O)O.C([C@H]([C@H]([C@@H]([C@H](C=O)N)O)O)O)O.OS(=O)(=O)O |
Computed by PubChem (NCBI)