CAS 103213-34-9 appears in our catalog under these names: Gly-Pro-pNA hydrochloride/ 99.41% (existing batch purity), Gly–Pro–pNA (hydrochloride), H-Gly-Pro-pNA•hydrochloride, GLY-PRO P-NITROANILIDE HYDROCHLORIDE&, GLY-PRO P-NITROANILIDE HYDROCHLORIDE, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 500mg, 250mg, 1g, 10mM/1mL.
1-(2-aminoacetyl)-N-(4-nitrophenyl)pyrrolidine-2-carboxamide;hydrochloride (CAS 103213-34-9) is a chemical compound with the molecular formula C13H17ClN4O4 and a molecular weight of 328.75 g/mol. IUPAC name: 1-(2-aminoacetyl)-N-(4-nitrophenyl)pyrrolidine-2-carboxamide;hydrochloride. InChIKey: VBBFIBMVFSUUBP-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN4O4 |
|---|---|
| Molecular weight | 328.75 g/mol |
| IUPAC name | 1-(2-aminoacetyl)-N-(4-nitrophenyl)pyrrolidine-2-carboxamide;hydrochloride |
| InChIKey | VBBFIBMVFSUUBP-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)C(=O)CN)C(=O)NC2=CC=C(C=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)