Glyceroltrivalerate, 95%
cas: 620-68-8 — see every product listed under this CAS number, including other names
Glyceroltrivalerate, 95% (CAS 620-68-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A104031-100mg |
| cas | 620-68-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 626.00 Pln | |
| Chemat | 5g | 1758.80 Pln | |
| BLDpharm | 100mg | 275.48 Pln | |
| BLDpharm | 250mg | 325.47 Pln | |
| BLDpharm | 1g | 608.70 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2,3-di(pentanoyloxy)propyl pentanoate (CAS 620-68-8) is a chemical compound with the molecular formula C18H32O6 and a molecular weight of 344.4 g/mol. IUPAC name: 2,3-di(pentanoyloxy)propyl pentanoate. InChIKey: PZJLFHDNXGAZHU-UHFFFAOYSA-N.
| Molecular formula | C18H32O6 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 2,3-di(pentanoyloxy)propyl pentanoate |
| InChIKey | PZJLFHDNXGAZHU-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)OCC(COC(=O)CCCC)OC(=O)CCCC |
Computed by PubChem (NCBI)