CAS 620-68-8 appears in our catalog under these names: Glycerol trivalerate, 98%, Glycerol Trivalerate, Glyceroltrivalerate 95%, GLYCEROL TRIVALERATE, >=98.0% GC, Glyceroltrivalerate, 95%, 95%. Offered by: Combi-blocks, TRC, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 250mg, 1g, 10g, 100mg, 5g.
2,3-di(pentanoyloxy)propyl pentanoate (CAS 620-68-8) is a chemical compound with the molecular formula C18H32O6 and a molecular weight of 344.4 g/mol. IUPAC name: 2,3-di(pentanoyloxy)propyl pentanoate. InChIKey: PZJLFHDNXGAZHU-UHFFFAOYSA-N.
| Molecular formula | C18H32O6 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 2,3-di(pentanoyloxy)propyl pentanoate |
| InChIKey | PZJLFHDNXGAZHU-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)OCC(COC(=O)CCCC)OC(=O)CCCC |
Computed by PubChem (NCBI)