cas: 142810-19-3 — see every product listed under this CAS number, including other names
Glycine, N-[N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-valyl]-, 98% (CAS 142810-19-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F863140-1G |
| cas | 142810-19-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 534.20 Pln | |
| Fluorochem | 10g | 877.83 Pln | |
| Fluorochem | 25g | 1684.84 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]acetic acid (CAS 142810-19-3) is a chemical compound with the molecular formula C22H24N2O5 and a molecular weight of 396.4 g/mol. IUPAC name: 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]acetic acid. InChIKey: RWMPPRIMKZLKTB-FQEVSTJZSA-N.
| Molecular formula | C22H24N2O5 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]acetic acid |
| InChIKey | RWMPPRIMKZLKTB-FQEVSTJZSA-N |
| SMILES | CC(C)[C@@H](C(=O)NCC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)