CAS 142810-19-3 appears in our catalog under these names: Fmoc-val-gly-oh, 95%, Fmoc–Val–Gly–OH, Fmoc-L-Val-Gly-OH, Fmoc-Val-Gly-OH, Fmoc-Val-Gly-OH 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 5g, 1g, 250mg, 25g, 1000mg, 500mg, 2000mg, 5000mg.
2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]acetic acid (CAS 142810-19-3) is a chemical compound with the molecular formula C22H24N2O5 and a molecular weight of 396.4 g/mol. IUPAC name: 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]acetic acid. InChIKey: RWMPPRIMKZLKTB-FQEVSTJZSA-N.
| Molecular formula | C22H24N2O5 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]acetic acid |
| InChIKey | RWMPPRIMKZLKTB-FQEVSTJZSA-N |
| SMILES | CC(C)[C@@H](C(=O)NCC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)