Gnetifolin E
cas: 140671-07-4 — see every product listed under this CAS number, including other names
Gnetifolin E (CAS 140671-07-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg, 5 mg. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress.
| brand | TargetMol |
|---|---|
| catalog number | TN5746-1mg |
| cas | 140671-07-4 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 3659.65 Pln | |
| TargetMol | 5mg | 7199.80 Pln | |
| TargetMol | 10mg | 9536.98 Pln | |
| TargetMol | 25mg | 14265.56 Pln | |
| TargetMol | 50mg | 18748.18 Pln | |
| TargetMol | 100mg | 25242.64 Pln | |
| Biosynth | 25mg | price on request | |
| Biosynth | 10mg | price on request | |
| Biosynth | 50mg | price on request | |
| Chemat | 50mg | 13701.20 Pln | |
| Chemat | 100mg | 19283.60 Pln | |
| MedChemExpress | 1 mg | 2279.46 Pln | |
| MedChemExpress | 5 mg | 4726.85 Pln | |
| Chemat | 1mg | 2104.40 Pln | |
| Chemat | 5mg | 4662.80 Pln | |
| Chemat | 10mg | 6165.20 Pln | |
| Chemat | 25mg | 9218.00 Pln | |
| Sigma-Aldrich | 1MG | 1392.00 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 19 days |
(2S,3R,4S,5S,6R)-2-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 140671-07-4) is a chemical compound with the molecular formula C21H24O9 and a molecular weight of 420.4 g/mol. IUPAC name: (2S,3R,4S,5S,6R)-2-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: CVPYYBCSHSCXJQ-DXKBKAGUSA-N.
| Molecular formula | C21H24O9 |
|---|---|
| Molecular weight | 420.4 g/mol |
| IUPAC name | (2S,3R,4S,5S,6R)-2-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | CVPYYBCSHSCXJQ-DXKBKAGUSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/C2=CC(=CC(=C2)O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
Computed by PubChem (NCBI)