CAS 4319-68-0 appears in our catalog under these names: 4'-Deoxyphlorizin, >95% (HPLC), 4'–Deoxyphlorizin, 4'-Deoxyphlorizin, 4'-Deoxyphlorizin, ≥97%, ≥97%. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 25mg, 5mg, 1g, 0,5g, 2g, 2mg.
3-(4-hydroxyphenyl)-1-[2-hydroxy-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propan-1-one (CAS 4319-68-0) is a chemical compound with the molecular formula C21H24O9 and a molecular weight of 420.4 g/mol. IUPAC name: 3-(4-hydroxyphenyl)-1-[2-hydroxy-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propan-1-one. InChIKey: KOTXSQPZNZHNFC-UHFFFAOYSA-N.
| Molecular formula | C21H24O9 |
|---|---|
| Molecular weight | 420.4 g/mol |
| IUPAC name | 3-(4-hydroxyphenyl)-1-[2-hydroxy-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propan-1-one |
| InChIKey | KOTXSQPZNZHNFC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)OC2C(C(C(C(O2)CO)O)O)O)C(=O)CCC3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)