Products 2234897-35-7
CAS 2234897-35-7 appears in our catalog under these names: Grp94 Inhibitor-1/ 97.02% (existing batch purity), Grp94 Inhibitor–1, Grp94 inhibitor-1, rel-4-(((1R,4R)-4-hydroxycyclohexyl)amino)-4'-isopropyl-[1,1'-biphenyl]-3-carboxamide, 98%, 98%, Grp94 Inhibitor-1, 98.75%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg, 50 mg.
2-[(4-hydroxycyclohexyl)amino]-5-(4-propan-2-ylphenyl)benzamide (CAS 2234897-35-7) is a chemical compound with the molecular formula C22H28N2O2 and a molecular weight of 352.5 g/mol. IUPAC name: 2-[(4-hydroxycyclohexyl)amino]-5-(4-propan-2-ylphenyl)benzamide. InChIKey: JMGDXIHGWTVBMX-UHFFFAOYSA-N.
| Molecular formula | C22H28N2O2 |
|---|---|
| Molecular weight | 352.5 g/mol |
| IUPAC name | 2-[(4-hydroxycyclohexyl)amino]-5-(4-propan-2-ylphenyl)benzamide |
| InChIKey | JMGDXIHGWTVBMX-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2=CC(=C(C=C2)NC3CCC(CC3)O)C(=O)N |
Computed by PubChem (NCBI)