cas: 84545-70-0 — see every product listed under this CAS number, including other names
Guanidine, [4-(chloromethyl)-2-thiazolyl]-, hydrochloride (9CI) (CAS 84545-70-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G368-50mg |
| cas | 84545-70-0 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 122.00 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 549.20 Pln | |
| Chemat | 5g | 1902.80 Pln |
| delivery time | 3 weeks |
|---|
2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine;hydrochloride (CAS 84545-70-0) is a chemical compound with the molecular formula C5H8Cl2N4S and a molecular weight of 227.11 g/mol. IUPAC name: 2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine;hydrochloride. InChIKey: HPXWWLGOFMSKHV-UHFFFAOYSA-N.
| Molecular formula | C5H8Cl2N4S |
|---|---|
| Molecular weight | 227.11 g/mol |
| IUPAC name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine;hydrochloride |
| InChIKey | HPXWWLGOFMSKHV-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)N=C(N)N)CCl.Cl |
Computed by PubChem (NCBI)