CAS 84545-70-0 appears in our catalog under these names: N-((4-Chloromethyl)-2-thiozolyl)guanidine hydrochloride, 95%, Guanidine, [4-(chloromethyl)-2-thiazolyl]-, hydrochloride (9CI). Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 250mg, 1g, 50mg.
2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine;hydrochloride (CAS 84545-70-0) is a chemical compound with the molecular formula C5H8Cl2N4S and a molecular weight of 227.11 g/mol. IUPAC name: 2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine;hydrochloride. InChIKey: HPXWWLGOFMSKHV-UHFFFAOYSA-N.
| Molecular formula | C5H8Cl2N4S |
|---|---|
| Molecular weight | 227.11 g/mol |
| IUPAC name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine;hydrochloride |
| InChIKey | HPXWWLGOFMSKHV-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)N=C(N)N)CCl.Cl |
Computed by PubChem (NCBI)