cas: 760941-22-8 — see every product listed under this CAS number, including other names
H-β-Ala(thiophen-3-yl)-OH 95% (CAS 760941-22-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A111684-100mg |
| cas | 760941-22-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 464.94 Pln | |
| Ambeed | 250mg | 720.81 Pln | |
| Ambeed | 1g | 2016.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A111684 |
(3R)-3-amino-3-thiophen-3-ylpropanoic acid (CAS 760941-22-8) is a chemical compound with the molecular formula C7H9NO2S and a molecular weight of 171.22 g/mol. IUPAC name: (3R)-3-amino-3-thiophen-3-ylpropanoic acid. InChIKey: UPDVATYZQLTZOZ-ZCFIWIBFSA-N.
| Molecular formula | C7H9NO2S |
|---|---|
| Molecular weight | 171.22 g/mol |
| IUPAC name | (3R)-3-amino-3-thiophen-3-ylpropanoic acid |
| InChIKey | UPDVATYZQLTZOZ-ZCFIWIBFSA-N |
| SMILES | C1=CSC=C1[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)