CAS 760941-22-8 appears in our catalog under these names: (R)-3-Amino-3-(thiophen-3-yl)propanoic acid, 95%, (R)–3–amino–3–(thiophen–3–yl)propanoic acid, H-β-Ala(thiophen-3-yl)-OH 95%, (R)-3-Amino-3-(thiophen-3-yl)propanoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
(3R)-3-amino-3-thiophen-3-ylpropanoic acid (CAS 760941-22-8) is a chemical compound with the molecular formula C7H9NO2S and a molecular weight of 171.22 g/mol. IUPAC name: (3R)-3-amino-3-thiophen-3-ylpropanoic acid. InChIKey: UPDVATYZQLTZOZ-ZCFIWIBFSA-N.
| Molecular formula | C7H9NO2S |
|---|---|
| Molecular weight | 171.22 g/mol |
| IUPAC name | (3R)-3-amino-3-thiophen-3-ylpropanoic acid |
| InChIKey | UPDVATYZQLTZOZ-ZCFIWIBFSA-N |
| SMILES | C1=CSC=C1[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)