H-Aad(OMe)-OH.HCl 97%
cas: 147780-39-0 — see every product listed under this CAS number, including other names
H-Aad(OMe)-OH.HCl 97% (CAS 147780-39-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A420557-10g |
| cas | 147780-39-0 |
| size | 10g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 4214.06 Pln | |
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 2506.38 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A420557 |
(2S)-2-amino-6-methoxy-6-oxohexanoic acid;hydrochloride (CAS 147780-39-0) is a chemical compound with the molecular formula C7H14ClNO4 and a molecular weight of 211.64 g/mol. IUPAC name: (2S)-2-amino-6-methoxy-6-oxohexanoic acid;hydrochloride. InChIKey: IOPRBBKYRZVRBV-JEDNCBNOSA-N.
| Molecular formula | C7H14ClNO4 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | (2S)-2-amino-6-methoxy-6-oxohexanoic acid;hydrochloride |
| InChIKey | IOPRBBKYRZVRBV-JEDNCBNOSA-N |
| SMILES | COC(=O)CCC[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
H-AAD(OME)-OH HCl, H-Aad(OMe)-OH.HCl, H-Aad(OMe)-OHHCl, H-Aad(ome)-OH hydrochloride, Hexanedioic acid, 2-amino-, 6-methyl ester, hydrochloride, (S)- (9CI), (2S)-2-amino-6-methoxy-6-oxohexanoic acid;hydrochloride, (2S)-2-Aminoadipic acid 6-methyl ester hydrochloride, L-alpha-Aminoadipic acid delta-methyl ester hydrochloride, Hexanedioic acid, 2-amino-, 6-methyl ester, hydrochloride, (S)-, IOPRBBKYRZVRBV-JEDNCBNOSA-N