Products 23150-65-4
CAS 23150-65-4 appears in our catalog under these names: L-Glutamic acid dimethyl ester hydrochloride, 97%, L-Glutamic Acid Dimethyl Ester Hydrochloride, Dimethyl L-Glutamate Hydrochloride, H–Glu(OMe)–OMe·HCl, H-L-Glu(OMe)-OMe*HCl. Offered by: Combi-blocks, TRC, Mikromol, GLPBio, Iris Biotech. Available pack sizes: 100g, 25g, 500g, 5g, 10g, 50g, 25mg, 1000g.
Dimethyl (2S)-2-aminopentanedioate;hydrochloride (CAS 23150-65-4) is a chemical compound with the molecular formula C7H14ClNO4 and a molecular weight of 211.64 g/mol. IUPAC name: dimethyl (2S)-2-aminopentanedioate;hydrochloride. InChIKey: MFUPLHQOVIUESQ-JEDNCBNOSA-N.
| Molecular formula | C7H14ClNO4 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | dimethyl (2S)-2-aminopentanedioate;hydrochloride |
| InChIKey | MFUPLHQOVIUESQ-JEDNCBNOSA-N |
| SMILES | COC(=O)CC[C@@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
Dimethyl L-Glutamate Hydrochloride, glutamic acid dimethyl ester hydrochloride, Dimethyl L-2-aminoglutarate HCl, Dimethyl L-2-aminoglutarate hydrochloride, dimethyl glutamate hydrochloride, L-Glutamic acid, dimethyl ester, hydrochloride, GLUTAMIC ACID, DIMETHYL ESTER, HYDROCHLORIDE, L-, L-Glutamic acid dimethyl ester hydrochloride, H-Glu(OMe)-OMe.HCl, (S)-Dimethyl 2-aminopentanedioate hydrochloride