cas: 2072-71-1 — see every product listed under this CAS number, including other names
H-Cys(Carbamoyl)-OH, ≥95%, ≥95% (CAS 2072-71-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113IW2-100mg |
| cas | 2072-71-1 |
| size | 100mg |
| availability | 2.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 693.20 Pln | |
| Chemat | 500mg | 2253.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-amino-3-carbamoylsulfanylpropanoic acid (CAS 2072-71-1) is a chemical compound with the molecular formula C4H8N2O3S and a molecular weight of 164.19 g/mol. IUPAC name: (2R)-2-amino-3-carbamoylsulfanylpropanoic acid. InChIKey: YOAUVDYBDJTJJP-REOHCLBHSA-N.
| Molecular formula | C4H8N2O3S |
|---|---|
| Molecular weight | 164.19 g/mol |
| IUPAC name | (2R)-2-amino-3-carbamoylsulfanylpropanoic acid |
| InChIKey | YOAUVDYBDJTJJP-REOHCLBHSA-N |
| SMILES | C([C@@H](C(=O)O)N)SC(=O)N |
Computed by PubChem (NCBI)