CAS 2072-71-1 appears in our catalog under these names: H-Cys(carbamoyl)-oh, 97%, H–Cys(carbamoyl)–OH, H-Cys(Carbamoyl)-OH, ≥95%, ≥95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 5g, 25g, 100mg, 500mg.
(2R)-2-amino-3-carbamoylsulfanylpropanoic acid (CAS 2072-71-1) is a chemical compound with the molecular formula C4H8N2O3S and a molecular weight of 164.19 g/mol. IUPAC name: (2R)-2-amino-3-carbamoylsulfanylpropanoic acid. InChIKey: YOAUVDYBDJTJJP-REOHCLBHSA-N.
| Molecular formula | C4H8N2O3S |
|---|---|
| Molecular weight | 164.19 g/mol |
| IUPAC name | (2R)-2-amino-3-carbamoylsulfanylpropanoic acid |
| InChIKey | YOAUVDYBDJTJJP-REOHCLBHSA-N |
| SMILES | C([C@@H](C(=O)O)N)SC(=O)N |
Computed by PubChem (NCBI)