cas: 87421-23-6 — see every product listed under this CAS number, including other names
H-D-(3S)-3-OH-Leu-OH 97% (CAS 87421-23-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A107697-50mg |
| cas | 87421-23-6 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 893.25 Pln | |
| Ambeed | 100mg | 1516.25 Pln | |
| Ambeed | 250mg | 2784.50 Pln | |
| Ambeed | 1g | 8219.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A107697 |
(2R,3S)-2-amino-3-hydroxy-4-methylpentanoic acid (CAS 87421-23-6) is a chemical compound with the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. IUPAC name: (2R,3S)-2-amino-3-hydroxy-4-methylpentanoic acid. InChIKey: ZAYJDMWJYCTABM-UHNVWZDZSA-N.
| Molecular formula | C6H13NO3 |
|---|---|
| Molecular weight | 147.17 g/mol |
| IUPAC name | (2R,3S)-2-amino-3-hydroxy-4-methylpentanoic acid |
| InChIKey | ZAYJDMWJYCTABM-UHNVWZDZSA-N |
| SMILES | CC(C)[C@@H]([C@H](C(=O)O)N)O |
Computed by PubChem (NCBI)