CAS 174457-99-9 appears in our catalog under these names: H-D-Asp(OBzl)-OBzl.HCl, 97%, 97%, D-Aspartic acid, 1,4-bis(phenylmethyl) ester, hydrochloride (1:1), 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g, 10g.
Dibenzyl (2R)-2-aminobutanedioate;hydrochloride (CAS 174457-99-9) is a chemical compound with the molecular formula C18H20ClNO4 and a molecular weight of 349.8 g/mol. IUPAC name: dibenzyl (2R)-2-aminobutanedioate;hydrochloride. InChIKey: ILBZEWOOBCRRAP-PKLMIRHRSA-N.
| Molecular formula | C18H20ClNO4 |
|---|---|
| Molecular weight | 349.8 g/mol |
| IUPAC name | dibenzyl (2R)-2-aminobutanedioate;hydrochloride |
| InChIKey | ILBZEWOOBCRRAP-PKLMIRHRSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C[C@H](C(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)