Products 5083-84-1
CAS 5083-84-1 is the registry number for Norisoboldine (hydrochloride), 99.72%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 50 mg, 10 mg, 25 mg.
(6aS)-2,10-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,9-diol;hydrochloride (CAS 5083-84-1) is a chemical compound with the molecular formula C18H20ClNO4 and a molecular weight of 349.8 g/mol. IUPAC name: (6aS)-2,10-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,9-diol;hydrochloride. InChIKey: POXNVTUOIYRUGG-YDALLXLXSA-N.
| Molecular formula | C18H20ClNO4 |
|---|---|
| Molecular weight | 349.8 g/mol |
| IUPAC name | (6aS)-2,10-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,9-diol;hydrochloride |
| InChIKey | POXNVTUOIYRUGG-YDALLXLXSA-N |
| SMILES | COC1=C(C2=C3[C@H](CC4=CC(=C(C=C42)OC)O)NCCC3=C1)O.Cl |
Computed by PubChem (NCBI)