CAS 25698-37-7 appears in our catalog under these names: (R)–2–Amino–2–(3–chlorophenyl)acetic acid, (R)-2-Amino-2-(3-chlorophenyl)acetic acid, 95%, 95%, H-D-Phg(3-Cl)-OH, 95%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 100mg, 1g, 250mg.
(2R)-2-amino-2-(3-chlorophenyl)acetic acid (CAS 25698-37-7) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: (2R)-2-amino-2-(3-chlorophenyl)acetic acid. InChIKey: MGOUENCSVMAGSE-SSDOTTSWSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | (2R)-2-amino-2-(3-chlorophenyl)acetic acid |
| InChIKey | MGOUENCSVMAGSE-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)